Products 1892049-22-7
CAS 1892049-22-7 is the registry number for 3-(4-{((tert-Butoxy)carbonyl)amino}phenyl)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid (CAS 1892049-22-7) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 3-methyl-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid. InChIKey: NSHKQAJYUDSBFT-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 3-methyl-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid |
| InChIKey | NSHKQAJYUDSBFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(C)(C)CC(=O)O |
Computed by PubChem (NCBI)