Products 1892461-96-9
CAS 1892461-96-9 appears in our catalog under these names: 3-{5H-Pyrido(4,3-b)indol-7-yl}propanoic acid, 3-{5H-pyrido[4,3-b]indol-7-yl}propanoic acid, 98%, 98%, Aberrant tau ligand 1, 99.33%, Aberrant tau ligand 1, 98%, 3-(5H-Pyrido[4,3-b]indol-7-yl)propanoic acid, 98%. Offered by: Biosynth, Chemat, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 100mg, 10 mg, 5 mg, 250mg.
3-(5H-pyrido[4,3-b]indol-7-yl)propanoic acid (CAS 1892461-96-9) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 3-(5H-pyrido[4,3-b]indol-7-yl)propanoic acid. InChIKey: FFZYKDATHLINEZ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 3-(5H-pyrido[4,3-b]indol-7-yl)propanoic acid |
| InChIKey | FFZYKDATHLINEZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCC(=O)O)NC3=C2C=NC=C3 |
Computed by PubChem (NCBI)