Products 1892785-04-4
CAS 1892785-04-4 is the registry number for 5-Bromo-2-(methoxymethyl)-1-methyl-1H-indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(methoxymethyl)-1-methylindole (CAS 1892785-04-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 5-bromo-2-(methoxymethyl)-1-methylindole. InChIKey: LRFXMRSPOWLALP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 5-bromo-2-(methoxymethyl)-1-methylindole |
| InChIKey | LRFXMRSPOWLALP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C=C1COC |
Computed by PubChem (NCBI)