CAS 1893211-85-2 is the registry number for 7-Bromo-2-(4-methoxyphenyl)-(1,2,4)triazolo(1,5-a)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-2-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 1893211-85-2) is a chemical compound with the molecular formula C13H10BrN3O and a molecular weight of 304.14 g/mol. IUPAC name: 7-bromo-2-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: HCNXNPFKYAUPDR-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 7-bromo-2-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | HCNXNPFKYAUPDR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)