CAS 80493-78-3 is the registry number for 2-(3-aminoimidazo(1,2-a)pyridin-2-yl)-4-bromophenol, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(3-aminoimidazo[1,2-a]pyridin-2-yl)-4-bromophenol (CAS 80493-78-3) is a chemical compound with the molecular formula C13H10BrN3O and a molecular weight of 304.14 g/mol. IUPAC name: 2-(3-aminoimidazo[1,2-a]pyridin-2-yl)-4-bromophenol. InChIKey: RZISKWBAFQDDNE-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 2-(3-aminoimidazo[1,2-a]pyridin-2-yl)-4-bromophenol |
| InChIKey | RZISKWBAFQDDNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)N)C3=C(C=CC(=C3)Br)O |
Computed by PubChem (NCBI)