CAS 879362-27-3 is the registry number for 3-(3-(3-Bromophenyl)-4-formyl-1H-pyrazol-1-yl)propanenitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[3-(3-bromophenyl)-4-formylpyrazol-1-yl]propanenitrile (CAS 879362-27-3) is a chemical compound with the molecular formula C13H10BrN3O and a molecular weight of 304.14 g/mol. IUPAC name: 3-[3-(3-bromophenyl)-4-formylpyrazol-1-yl]propanenitrile. InChIKey: DXVQYIWQRFFGKH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 3-[3-(3-bromophenyl)-4-formylpyrazol-1-yl]propanenitrile |
| InChIKey | DXVQYIWQRFFGKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN(C=C2C=O)CCC#N |
Computed by PubChem (NCBI)