CAS 2592326-37-7 is the registry number for 8-(Benzyloxy)-5-bromo-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-8-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine (CAS 2592326-37-7) is a chemical compound with the molecular formula C13H10BrN3O and a molecular weight of 304.14 g/mol. IUPAC name: 5-bromo-8-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: GEABWIRTMXJELD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 5-bromo-8-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | GEABWIRTMXJELD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(N3C2=NC=N3)Br |
Computed by PubChem (NCBI)