CAS 189353-32-0 appears in our catalog under these names: Fadolmidine Hydrochloride, >95% (HPLC), Fadolmidine hydrochloride, Fadolmidine (hydrochloride). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, Get quote.
3-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1H-inden-5-ol;hydrochloride (CAS 189353-32-0) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 3-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1H-inden-5-ol;hydrochloride. InChIKey: OYKZVKWXOWICFI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 3-(1H-imidazol-5-ylmethyl)-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| InChIKey | OYKZVKWXOWICFI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CC3=CN=CN3)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)