Products 1894904-12-1

CAS 1894904-12-1 is the registry number for 4-(5-Oxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

4-(2-oxo-3H-1,3,4-oxadiazol-5-yl)benzoic acid (CAS 1894904-12-1) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 4-(2-oxo-3H-1,3,4-oxadiazol-5-yl)benzoic acid. InChIKey: QTSDRMFLRKPBLV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O4
Molecular weight206.15 g/mol
IUPAC name4-(2-oxo-3H-1,3,4-oxadiazol-5-yl)benzoic acid
InChIKeyQTSDRMFLRKPBLV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NNC(=O)O2)C(=O)O

Computed by PubChem (NCBI)