Products 1895624-11-9
CAS 1895624-11-9 is the registry number for 5-(2,5-Dimethoxyphenyl)-3-methylisoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,5-dimethoxyphenyl)-3-methyl-1,2-oxazole (CAS 1895624-11-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 5-(2,5-dimethoxyphenyl)-3-methyl-1,2-oxazole. InChIKey: IKIKZAPPSCCUJJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-(2,5-dimethoxyphenyl)-3-methyl-1,2-oxazole |
| InChIKey | IKIKZAPPSCCUJJ-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=C(C=CC(=C2)OC)OC |
Computed by PubChem (NCBI)