Products 189690-91-3
CAS 189690-91-3 appears in our catalog under these names: methyl (2S,3S)-3-ethylpyrrolidine-2-carboxylate hydrochloride, 97%, 97%, methyl (2S,3S)-3-ethylpyrrolidine-2-carboxylate,hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
Methyl (2S,3S)-3-ethylpyrrolidine-2-carboxylate;hydrochloride (CAS 189690-91-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S,3S)-3-ethylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: UULFFIJPLBXISM-LEUCUCNGSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S,3S)-3-ethylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | UULFFIJPLBXISM-LEUCUCNGSA-N |
| SMILES | CC[C@H]1CCN[C@@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)