CAS 2806738-88-3 is the registry number for methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate,hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride (CAS 2806738-88-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: UULFFIJPLBXISM-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | UULFFIJPLBXISM-HHQFNNIRSA-N |
| SMILES | CC[C@@H]1CCN[C@@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)