Products 2806738-88-3

CAS 2806738-88-3 is the registry number for methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate,hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride (CAS 2806738-88-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: UULFFIJPLBXISM-HHQFNNIRSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC namemethyl (2S,3R)-3-ethylpyrrolidine-2-carboxylate;hydrochloride
InChIKeyUULFFIJPLBXISM-HHQFNNIRSA-N
SMILESCC[C@@H]1CCN[C@@H]1C(=O)OC.Cl

Computed by PubChem (NCBI)