CAS 1897388-80-5 is the registry number for Methyl (2S)-2,4-Dimethyl-4-nitro-pentanoate. Offered by: TRC. Available pack sizes: 250mg.
Methyl (2S)-2,4-dimethyl-4-nitropentanoate (CAS 1897388-80-5) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: methyl (2S)-2,4-dimethyl-4-nitropentanoate. InChIKey: FIXGUDASGASFSO-LURJTMIESA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl (2S)-2,4-dimethyl-4-nitropentanoate |
| InChIKey | FIXGUDASGASFSO-LURJTMIESA-N |
| SMILES | C[C@@H](CC(C)(C)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)