CAS 1897687-95-4 is the registry number for 3-(4-Methyl-1,3-oxazol-2-yl)benzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(4-methyl-1,3-oxazol-2-yl)benzaldehyde (CAS 1897687-95-4) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-(4-methyl-1,3-oxazol-2-yl)benzaldehyde. InChIKey: KUBHUIYOABTOGH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-(4-methyl-1,3-oxazol-2-yl)benzaldehyde |
| InChIKey | KUBHUIYOABTOGH-UHFFFAOYSA-N |
| SMILES | CC1=COC(=N1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)