CAS 1898399-52-4 is the registry number for ethyl 2-(4-ethoxy-2,3-difluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(4-ethoxy-2,3-difluorophenyl)-2-oxoacetate (CAS 1898399-52-4) is a chemical compound with the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. IUPAC name: ethyl 2-(4-ethoxy-2,3-difluorophenyl)-2-oxoacetate. InChIKey: CCEBAXALPQVAES-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O4 |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | ethyl 2-(4-ethoxy-2,3-difluorophenyl)-2-oxoacetate |
| InChIKey | CCEBAXALPQVAES-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)C(=O)OCC)F)F |
Computed by PubChem (NCBI)