CAS 18992-65-9 appears in our catalog under these names: 2,7–Dimethylcarbazole, 2,7-Dimethyl-9H-carbazole, >98.0%(GC), 2,7-Dimethyl-9H-carbazole 98%, 2,7-Dimethyl-9H-carbazole, 98%, 98%, 2,7-Dimethyl-9H-carbazole, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 200mg, 5g, 100mg.
2,7-dimethyl-9H-carbazole (CAS 18992-65-9) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 2,7-dimethyl-9H-carbazole. InChIKey: ABYRPCUQHCOXMX-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 2,7-dimethyl-9H-carbazole |
| InChIKey | ABYRPCUQHCOXMX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(N2)C=C(C=C3)C |
Computed by PubChem (NCBI)