CAS 2059940-53-1 is the registry number for 3-Chloro-1H,1aH,6H,6aH-cyclopropa(a)indene-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (CAS 2059940-53-1) is a chemical compound with the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. IUPAC name: 3-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid. InChIKey: WLJLPPNLAMGCOO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| InChIKey | WLJLPPNLAMGCOO-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C(=O)O)C3=C1C=CC(=C3)Cl |
Computed by PubChem (NCBI)