CAS 2044796-35-0 appears in our catalog under these names: 4-Chloro-1H,1aH,6H,6aH-cyclopropa(a)indene-1-carboxylic acid, 95%, 4-Chloro-1H,1aH,6H,6aH-cyclopropa(A)indene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (CAS 2044796-35-0) is a chemical compound with the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. IUPAC name: 4-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid. InChIKey: QCHGODCFACBXAX-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 4-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| InChIKey | QCHGODCFACBXAX-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C(=O)O)C3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)