CAS 190137-08-7 is the registry number for Dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate (CAS 190137-08-7) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate. InChIKey: SQFQEQDRLAZVJQ-KNVOCYPGSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate |
| InChIKey | SQFQEQDRLAZVJQ-KNVOCYPGSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)C(=O)OC |
Computed by PubChem (NCBI)