CAS 1903431-86-6 appears in our catalog under these names: Rel-tert-butyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate, 98%, rac-tert-Butyl N-((3R,4R)-4-(hydroxymethyl)oxolan-3-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate (CAS 1903431-86-6) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate. InChIKey: RBFZUVZVPAETHZ-JGVFFNPUSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate |
| InChIKey | RBFZUVZVPAETHZ-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1CO |
Computed by PubChem (NCBI)