CAS 2472560-02-2 is the registry number for tert-Butyl ((3R,4S)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate (CAS 2472560-02-2) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate. InChIKey: RBFZUVZVPAETHZ-YUMQZZPRSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamate |
| InChIKey | RBFZUVZVPAETHZ-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[C@@H]1CO |
Computed by PubChem (NCBI)