Products 19048-85-2
CAS 19048-85-2 is the registry number for (4-chlorophenyl)methyl 4-chlorobenzoate, 98%. Offered by: Chemat. Available pack sizes: 1g.
(4-chlorophenyl)methyl 4-chlorobenzoate (CAS 19048-85-2) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: (4-chlorophenyl)methyl 4-chlorobenzoate. InChIKey: SVQZZBZDBJHCAL-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | (4-chlorophenyl)methyl 4-chlorobenzoate |
| InChIKey | SVQZZBZDBJHCAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)