CAS 2008714-28-9 is the registry number for tert-Butyl (1S,2S,4R)-7-azabicyclo(2.2.1)heptan-2-ylcarbamate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride (CAS 2008714-28-9) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride. InChIKey: CTUPSFKVOJMISH-KEMIKLHMSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride |
| InChIKey | CTUPSFKVOJMISH-KEMIKLHMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2CC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)