CAS 1909288-59-0 is the registry number for rac-((1R,3R)-2,2-Dimethyl-3-phenylcyclopropyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
[(1S,3S)-2,2-dimethyl-3-phenylcyclopropyl]methanamine;hydrochloride (CAS 1909288-59-0) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: [(1S,3S)-2,2-dimethyl-3-phenylcyclopropyl]methanamine;hydrochloride. InChIKey: SDJLLVIIFVIVDW-ACMTZBLWSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | [(1S,3S)-2,2-dimethyl-3-phenylcyclopropyl]methanamine;hydrochloride |
| InChIKey | SDJLLVIIFVIVDW-ACMTZBLWSA-N |
| SMILES | CC1([C@H]([C@@H]1C2=CC=CC=C2)CN)C.Cl |
Computed by PubChem (NCBI)