Products 1909288-68-1
CAS 1909288-68-1 is the registry number for rac-(4R,5S)-4-(Aminomethyl)-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(4R,5S)-4-(aminomethyl)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one (CAS 1909288-68-1) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: (4R,5S)-4-(aminomethyl)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one. InChIKey: ZEMJKHDUMSCSIO-MWLCHTKSSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | (4R,5S)-4-(aminomethyl)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one |
| InChIKey | ZEMJKHDUMSCSIO-MWLCHTKSSA-N |
| SMILES | CN1[C@@H]([C@H](CC1=O)CN)C2=CN=CC=C2 |
Computed by PubChem (NCBI)