CAS 1909301-23-0 appears in our catalog under these names: 4-{1-hydroxy-1-((2R)-1-methylpyrrolidin-2-yl)ethyl}phenol, 95%, 4-{1-Hydroxy-1-((2R)-1-methylpyrrolidin-2-yl)ethyl}phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[1-hydroxy-1-[(2R)-1-methylpyrrolidin-2-yl]ethyl]phenol (CAS 1909301-23-0) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 4-[1-hydroxy-1-[(2R)-1-methylpyrrolidin-2-yl]ethyl]phenol. InChIKey: NCOJGMWSQHQPRG-PZORYLMUSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 4-[1-hydroxy-1-[(2R)-1-methylpyrrolidin-2-yl]ethyl]phenol |
| InChIKey | NCOJGMWSQHQPRG-PZORYLMUSA-N |
| SMILES | CC([C@H]1CCCN1C)(C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)