Products 1909305-45-8
CAS 1909305-45-8 is the registry number for 2-(4-Methoxyphenyl)-2-((propan-2-yl)amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetic acid;hydrochloride (CAS 1909305-45-8) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: 2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetic acid;hydrochloride. InChIKey: LHUWGPDEZGZWRS-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-2-(propan-2-ylamino)acetic acid;hydrochloride |
| InChIKey | LHUWGPDEZGZWRS-UHFFFAOYSA-N |
| SMILES | CC(C)NC(C1=CC=C(C=C1)OC)C(=O)O.Cl |
Computed by PubChem (NCBI)