Products 1909308-65-1
CAS 1909308-65-1 is the registry number for tert-Butyl 3-amino-2,3-dihydro-1H-indene-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-amino-2,3-dihydro-1H-indene-1-carboxylate (CAS 1909308-65-1) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: tert-butyl 3-amino-2,3-dihydro-1H-indene-1-carboxylate. InChIKey: JNARGVBQPSLVNS-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | tert-butyl 3-amino-2,3-dihydro-1H-indene-1-carboxylate |
| InChIKey | JNARGVBQPSLVNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C2=CC=CC=C12)N |
Computed by PubChem (NCBI)