CAS 2648902-30-9 is the registry number for tert-Butyl (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxylate (CAS 2648902-30-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: tert-butyl (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxylate. InChIKey: JNARGVBQPSLVNS-NEPJUHHUSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | tert-butyl (1R,3S)-3-amino-2,3-dihydro-1H-indene-1-carboxylate |
| InChIKey | JNARGVBQPSLVNS-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](C2=CC=CC=C12)N |
Computed by PubChem (NCBI)