CAS 1909313-89-8 appears in our catalog under these names: 4,4-Dimethyl-2-phenylpyrrolidine hydrochloride, 98%, 4,4-Dimethyl-2-phenylpyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,4-dimethyl-2-phenylpyrrolidine;hydrochloride (CAS 1909313-89-8) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 4,4-dimethyl-2-phenylpyrrolidine;hydrochloride. InChIKey: BJVZSQKLWRBULR-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 4,4-dimethyl-2-phenylpyrrolidine;hydrochloride |
| InChIKey | BJVZSQKLWRBULR-UHFFFAOYSA-N |
| SMILES | CC1(CC(NC1)C2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)