Products 1909319-00-1
CAS 1909319-00-1 is the registry number for 5-(4-Aminophenyl)-3,5-dimethylimidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(4-aminophenyl)-3,5-dimethylimidazolidine-2,4-dione (CAS 1909319-00-1) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 5-(4-aminophenyl)-3,5-dimethylimidazolidine-2,4-dione. InChIKey: JECMGCYXCUNLQH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-(4-aminophenyl)-3,5-dimethylimidazolidine-2,4-dione |
| InChIKey | JECMGCYXCUNLQH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)C)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)