Products 1909325-45-6
CAS 1909325-45-6 is the registry number for 1-(2-(Dimethylamino)ethyl)-1H-pyrazole-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[2-(dimethylamino)ethyl]pyrazole-3-carboxylic acid;hydrochloride (CAS 1909325-45-6) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: 1-[2-(dimethylamino)ethyl]pyrazole-3-carboxylic acid;hydrochloride. InChIKey: AIVVGVNCGNIHIC-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethyl]pyrazole-3-carboxylic acid;hydrochloride |
| InChIKey | AIVVGVNCGNIHIC-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C=CC(=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)