CAS 1909337-13-8 appears in our catalog under these names: 3-Chloro-4,5-dimethoxyaniline hydrochloride, 3-Chloro-4,5-dimethoxyaniline hydrochloride, 95%+, 95%+, 3-chloro-4,5-dimethoxyaniline hydrochloride, 95%+. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-chloro-4,5-dimethoxyaniline;hydrochloride (CAS 1909337-13-8) is a chemical compound with the molecular formula C8H11Cl2NO2 and a molecular weight of 224.08 g/mol. IUPAC name: 3-chloro-4,5-dimethoxyaniline;hydrochloride. InChIKey: MTZWXRYPMUEDRB-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO2 |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 3-chloro-4,5-dimethoxyaniline;hydrochloride |
| InChIKey | MTZWXRYPMUEDRB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)N)Cl)OC.Cl |
Computed by PubChem (NCBI)