Products 1909358-78-6
CAS 1909358-78-6 is the registry number for 3-Chloro-2-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-chloro-2-phenylprop-2-enamide (CAS 1909358-78-6) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: (E)-3-chloro-2-phenylprop-2-enamide. InChIKey: LGLMCVXVVHYYHG-SOFGYWHQSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (E)-3-chloro-2-phenylprop-2-enamide |
| InChIKey | LGLMCVXVVHYYHG-SOFGYWHQSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\Cl)/C(=O)N |
Computed by PubChem (NCBI)