Products 1910-90-3
CAS 1910-90-3 appears in our catalog under these names: 6-Bromo-1,4-dihydroquinoxaline-2,3-dione, 96%, 6–Bromoquinoxaline–2，3(1H，4H)–dione, 6-Bromoquinoxaline-2,3(1h,4h)-dione, 6-bromo-2,3-quinoxalinediol, 97%, 6-Bromoquinoxaline-2,3(1H,4H)-dione, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 2,5g, 250mg.
6-bromo-1,4-dihydroquinoxaline-2,3-dione (CAS 1910-90-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-1,4-dihydroquinoxaline-2,3-dione. InChIKey: KCEGUPPDVPWCCX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | KCEGUPPDVPWCCX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)