Products 1910806-09-5

CAS 1910806-09-5 is the registry number for 2-Isopropyl-1,3-thiazolidine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid;hydrochloride (CAS 1910806-09-5) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: 2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid;hydrochloride. InChIKey: GIFNNKRNZWNMBT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2S
Molecular weight211.71 g/mol
IUPAC name2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid;hydrochloride
InChIKeyGIFNNKRNZWNMBT-UHFFFAOYSA-N
SMILESCC(C)C1NC(CS1)C(=O)O.Cl

Computed by PubChem (NCBI)