CAS 2309447-70-7 is the registry number for 6-(methylsulfonyl)-2-Azaspiro(3.3)heptane hydrochloride. Offered by: Chemat Brand. Available pack sizes: on request.
6-methylsulfonyl-2-azaspiro[3.3]heptane;hydrochloride (CAS 2309447-70-7) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: 6-methylsulfonyl-2-azaspiro[3.3]heptane;hydrochloride. InChIKey: ZONDRDSKGFXTQR-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO2S |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 6-methylsulfonyl-2-azaspiro[3.3]heptane;hydrochloride |
| InChIKey | ZONDRDSKGFXTQR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1CC2(C1)CNC2.Cl |
Computed by PubChem (NCBI)