Products 2756589-94-1
CAS 2756589-94-1 is the registry number for (S)-1-Thia-6-azaspiro[3.5]nonane 1,1-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride (CAS 2756589-94-1) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: (4S)-1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride. InChIKey: CFWADAMMOKVGRT-FJXQXJEOSA-N.
| Molecular formula | C7H14ClNO2S |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | (4S)-1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride |
| InChIKey | CFWADAMMOKVGRT-FJXQXJEOSA-N |
| SMILES | C1C[C@]2(CCS2(=O)=O)CNC1.Cl |
Computed by PubChem (NCBI)