Products 83842-57-3

CAS 83842-57-3 appears in our catalog under these names: Cyclohexyl(methyl)sulfamoyl chloride, 95%, N-Cyclohexyl-N-methylsulfamoyl chloride, 98%, N-Cyclohexyl-N-methylsulfamoyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.

Structural formula: {0} (CAS {1})

N-cyclohexyl-N-methylsulfamoyl chloride (CAS 83842-57-3) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: N-cyclohexyl-N-methylsulfamoyl chloride. InChIKey: RQDWFSSEDVWNMI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2S
Molecular weight211.71 g/mol
IUPAC nameN-cyclohexyl-N-methylsulfamoyl chloride
InChIKeyRQDWFSSEDVWNMI-UHFFFAOYSA-N
SMILESCN(C1CCCCC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)