CAS 1910845-11-2 is the registry number for Tadalafil Impurity 97. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1R,3R)-1-(3,4-dihydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 1910845-11-2) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: methyl (1R,3R)-1-(3,4-dihydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: IIXHSDPDDYPNEN-RHSMWYFYSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | methyl (1R,3R)-1-(3,4-dihydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | IIXHSDPDDYPNEN-RHSMWYFYSA-N |
| SMILES | COC(=O)[C@H]1CC2=C([C@H](N1)C3=CC(=C(C=C3)O)O)NC4=CC=CC=C24 |
Computed by PubChem (NCBI)