Products 653573-24-1

CAS 653573-24-1 is the registry number for Diethyl 3-(1H-indol-4-yl)pyridine-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Diethyl 3-(1H-indol-4-yl)pyridine-2,5-dicarboxylate (CAS 653573-24-1) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: diethyl 3-(1H-indol-4-yl)pyridine-2,5-dicarboxylate. InChIKey: TUOVPRFIXQVFAN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O4
Molecular weight338.4 g/mol
IUPAC namediethyl 3-(1H-indol-4-yl)pyridine-2,5-dicarboxylate
InChIKeyTUOVPRFIXQVFAN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(N=C1)C(=O)OCC)C2=C3C=CNC3=CC=C2

Computed by PubChem (NCBI)