Products 942289-81-8
CAS 942289-81-8 is the registry number for 1-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-2-propyl-1h-benzo[d]imidazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-propylbenzimidazole-5-carboxylic acid (CAS 942289-81-8) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-propylbenzimidazole-5-carboxylic acid. InChIKey: NSHGSXQRWAOJPA-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-propylbenzimidazole-5-carboxylic acid |
| InChIKey | NSHGSXQRWAOJPA-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1C3=CC4=C(C=C3)OCCO4)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)