Products 56976-66-0
CAS 56976-66-0 appears in our catalog under these names: Hydantoin Impurity 8, 5,5-Diphenylhydantoin-3-butyric Acid, >95% (HPLC), 5,5-Diphenylhydantoin-3-butyric acid. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
4-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)butanoic acid (CAS 56976-66-0) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: 4-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)butanoic acid. InChIKey: OVLJICGWRFYBAA-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 4-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)butanoic acid |
| InChIKey | OVLJICGWRFYBAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)N(C(=O)N2)CCCC(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)