CAS 94099-57-7 appears in our catalog under these names: L-Tyrosine 7-amido-4-methylcoumarin, H-Tyr-AMC, H–Tyr–AMC. Offered by: TRC, Creative Peptides, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 50mg, 1g, 500mg, 1000mg, 10mg, 100mg.
(2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 94099-57-7) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: NRGJYQDVMUOJLU-INIZCTEOSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | NRGJYQDVMUOJLU-INIZCTEOSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=C(C=C3)O)N |
Computed by PubChem (NCBI)