CAS 19123-67-2 appears in our catalog under these names: Gibberellic Acid 3-Isolactone, Isogibberellic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxylic acid (CAS 19123-67-2) is a chemical compound with the molecular formula C19H22O6 and a molecular weight of 346.4 g/mol. IUPAC name: 13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxylic acid. InChIKey: SLSYEBAZQRZQID-UHFFFAOYSA-N.
| Molecular formula | C19H22O6 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxylic acid |
| InChIKey | SLSYEBAZQRZQID-UHFFFAOYSA-N |
| SMILES | CC12C3C(C45CC(=C)C(C4)(CCC5C3=CC(C1O)OC2=O)O)C(=O)O |
Computed by PubChem (NCBI)