CAS 546-09-8 appears in our catalog under these names: Gibberellenic Acid, Gibberellenic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 2,5g, 250mg, 25 mg, 100 mg, 50 mg, 250 mg.
(1R,2S,3S,4S,5S,12S)-5,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadeca-6,8-diene-2,4-dicarboxylic acid (CAS 546-09-8) is a chemical compound with the molecular formula C19H22O6 and a molecular weight of 346.4 g/mol. IUPAC name: (1R,2S,3S,4S,5S,12S)-5,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadeca-6,8-diene-2,4-dicarboxylic acid. InChIKey: JAHZEMKSAYRHSW-SBECISRQSA-N.
| Molecular formula | C19H22O6 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (1R,2S,3S,4S,5S,12S)-5,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadeca-6,8-diene-2,4-dicarboxylic acid |
| InChIKey | JAHZEMKSAYRHSW-SBECISRQSA-N |
| SMILES | C[C@]1([C@H](C=CC2=C3CC[C@@]4(C[C@]3(CC4=C)[C@H]([C@@H]21)C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)