CAS 41137-86-4 is the registry number for Hirsutanonol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
(5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one (CAS 41137-86-4) is a chemical compound with the molecular formula C19H22O6 and a molecular weight of 346.4 g/mol. IUPAC name: (5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one. InChIKey: MVIYWFBLVAFZID-AWEZNQCLSA-N.
| Molecular formula | C19H22O6 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (5S)-1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one |
| InChIKey | MVIYWFBLVAFZID-AWEZNQCLSA-N |
| SMILES | C1=CC(=C(C=C1CC[C@@H](CC(=O)CCC2=CC(=C(C=C2)O)O)O)O)O |
Computed by PubChem (NCBI)