Products 6256-05-9

CAS 6256-05-9 is the registry number for 3,3-Bis(3,4-dimethoxyphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3,3-bis(3,4-dimethoxyphenyl)propanoic acid (CAS 6256-05-9) is a chemical compound with the molecular formula C19H22O6 and a molecular weight of 346.4 g/mol. IUPAC name: 3,3-bis(3,4-dimethoxyphenyl)propanoic acid. InChIKey: KSZUUOFEQVFRQF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22O6
Molecular weight346.4 g/mol
IUPAC name3,3-bis(3,4-dimethoxyphenyl)propanoic acid
InChIKeyKSZUUOFEQVFRQF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(CC(=O)O)C2=CC(=C(C=C2)OC)OC)OC

Computed by PubChem (NCBI)