CAS 1914176-39-8 is the registry number for 5,6-Dichloro-3-(tetrahydro-2h-pyran-2-yl)-3h-imidazo(4,5-b)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5,6-dichloro-3-(oxan-2-yl)imidazo[4,5-b]pyridine (CAS 1914176-39-8) is a chemical compound with the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. IUPAC name: 5,6-dichloro-3-(oxan-2-yl)imidazo[4,5-b]pyridine. InChIKey: AEFCUYPYJUVJRW-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3O |
|---|---|
| Molecular weight | 272.13 g/mol |
| IUPAC name | 5,6-dichloro-3-(oxan-2-yl)imidazo[4,5-b]pyridine |
| InChIKey | AEFCUYPYJUVJRW-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C=NC3=CC(=C(N=C32)Cl)Cl |
Computed by PubChem (NCBI)