CAS 191421-10-0 appears in our catalog under these names: 5–NIdR, 5-NIdR, 98%, 1-(2-Deoxy-b-D-ribofuranosyl)-5-nitroindole, 5-NIdR 98%, 5-NIdR, 98%, 98%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 250mg, 1g, 5g, 25mg, 5mg, 10mM (in 1ml dmso), 10g.
(2R,3S,5R)-2-(hydroxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-ol (CAS 191421-10-0) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-ol. InChIKey: ODPRBLIUAVWXNM-YNEHKIRRSA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-ol |
| InChIKey | ODPRBLIUAVWXNM-YNEHKIRRSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC3=C2C=CC(=C3)[N+](=O)[O-])CO)O |
Computed by PubChem (NCBI)